C38H48Cl2N2SiTi-2 — CID 58634441
[(3aS,7aS)-4-(3,5-ditert-butylphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-phenazin-10-id-5-ylsilane;carbanide;dichlorotitanium (PubChem CID 58634441) has the molecular formula C38H48Cl2N2SiTi-2 and a molecular weight of 679.67 g/mol. Its IUPAC name is [(3aS,7aS)-4-(3,5-ditert-butylphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-phenazin-10-id-5-ylsilane;carbanide;dichlorotitanium.
| Compound Name | [(3aS,7aS)-4-(3,5-ditert-butylphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-phenazin-10-id-5-ylsilane;carbanide;dichlorotitanium |
|---|---|
| PubChem CID | 58634441 |
| Molecular Formula | C38H48Cl2N2SiTi-2 |
| Molecular Weight | 679.67 g/mol |
| Exact Mass | 678.25 |
| IUPAC Name | [(3aS,7aS)-4-(3,5-ditert-butylphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-phenazin-10-id-5-ylsilane;carbanide;dichlorotitanium |
| SMILES | CC(C)(C)c1cc(C2=CC=C[C@@H]3C([Si](C)(C)N4c5ccccc5[N-]c5ccccc54)CC[C@H]23)cc(C(C)(C)C)c1.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C37H45N2Si.CH3.2ClH.Ti/c1-36(2,3)26-22-25(23-27(24-26)37(4,5)6)28-14-13-15-30-29(28)20-21-35(30)40(7,8)39-33-18-11-9-16-31(33)38-32-17-10-12-19-34(32)39;;;;/h9-19,22-24,29-30,35H,20-21H2,1-8H3;1H3;2*1H;/q2*-1;;;+2/p-2/t29-,30+,35?;;;;/m1..../s1 |
| InChIKey | OJNTWEPDIQOIJS-KKFAOZKRSA-L |
| XLogP | 13.15 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.67 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|