C37H42Cl2N2SiTi-2 — CID 58634538
[(7aR)-2,2-dimethyl-4-(3-phenylphenyl)-3a,7a-dihydrobenzimidazol-3-id-1-yl]-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-dimethylsilane;carbanide;dichlorotitanium (PubChem CID 58634538) has the molecular formula C37H42Cl2N2SiTi-2 and a molecular weight of 661.62 g/mol. Its IUPAC name is [(7aR)-2,2-dimethyl-4-(3-phenylphenyl)-3a,7a-dihydrobenzimidazol-3-id-1-yl]-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-dimethylsilane;carbanide;dichlorotitanium.
| Compound Name | [(7aR)-2,2-dimethyl-4-(3-phenylphenyl)-3a,7a-dihydrobenzimidazol-3-id-1-yl]-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-dimethylsilane;carbanide;dichlorotitanium |
|---|---|
| PubChem CID | 58634538 |
| Molecular Formula | C37H42Cl2N2SiTi-2 |
| Molecular Weight | 661.62 g/mol |
| Exact Mass | 660.20 |
| IUPAC Name | [(7aR)-2,2-dimethyl-4-(3-phenylphenyl)-3a,7a-dihydrobenzimidazol-3-id-1-yl]-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-dimethylsilane;carbanide;dichlorotitanium |
| SMILES | CC1(C)[N-]C2C(c3cccc(-c4ccccc4)c3)=CC=C[C@H]2N1[Si](C)(C)C1C2C=CC=CC2C2C=CC=CC21.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C36H39N2Si.CH3.2ClH.Ti/c1-36(2)37-34-28(27-17-12-16-26(24-27)25-14-6-5-7-15-25)22-13-23-33(34)38(36)39(3,4)35-31-20-10-8-18-29(31)30-19-9-11-21-32(30)35;;;;/h5-24,29-35H,1-4H3;1H3;2*1H;/q2*-1;;;+2/p-2/t29?,30?,31?,32?,33-,34?,35?;;;;/m1..../s1 |
| InChIKey | YBYNSPSPKAVHLL-OOCXSZIQSA-L |
| XLogP | 10.60 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.62 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|