C37H38N2Si — CID 58634764
[(2R,3aS,7aS)-2-ethyl-4-(3-phenylphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-(10H-phenazin-5-yl)silane (PubChem CID 58634764) has the molecular formula C37H38N2Si and a molecular weight of 538.81 g/mol. Its IUPAC name is [(2R,3aS,7aS)-2-ethyl-4-(3-phenylphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-(10H-phenazin-5-yl)silane.
| Compound Name | [(2R,3aS,7aS)-2-ethyl-4-(3-phenylphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-(10H-phenazin-5-yl)silane |
|---|---|
| PubChem CID | 58634764 |
| Molecular Formula | C37H38N2Si |
| Molecular Weight | 538.81 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | [(2R,3aS,7aS)-2-ethyl-4-(3-phenylphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-(10H-phenazin-5-yl)silane |
| SMILES | CC[C@@H]1C[C@@H]2C(c3cccc(-c4ccccc4)c3)=CC=C[C@@H]2C1[Si](C)(C)N1c2ccccc2Nc2ccccc21 |
| InChI | InChI=1S/C37H38N2Si/c1-4-26-25-32-30(29-17-12-16-28(24-29)27-14-6-5-7-15-27)18-13-19-31(32)37(26)40(2,3)39-35-22-10-8-20-33(35)38-34-21-9-11-23-36(34)39/h5-24,26,31-32,37-38H,4,25H2,1-3H3/t26-,31+,32-,37?/m1/s1 |
| InChIKey | PNJJQUKSXKSIRH-WCIJOIRTSA-N |
| XLogP | 10.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.81 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|