C54H72Si — CID 162270332
[4-(3,5-ditert-butyl-4-methylphenyl)-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-[2-hexyl-4-(2-phenylphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane (PubChem CID 162270332) has the molecular formula C54H72Si and a molecular weight of 749.26 g/mol. Its IUPAC name is [4-(3,5-ditert-butyl-4-methylphenyl)-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-[2-hexyl-4-(2-phenylphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane.
| Compound Name | [4-(3,5-ditert-butyl-4-methylphenyl)-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-[2-hexyl-4-(2-phenylphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 162270332 |
| Molecular Formula | C54H72Si |
| Molecular Weight | 749.26 g/mol |
| Exact Mass | 748.54 |
| IUPAC Name | [4-(3,5-ditert-butyl-4-methylphenyl)-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-[2-hexyl-4-(2-phenylphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane |
| SMILES | CCCCCCC1CC2C(c3ccccc3-c3ccccc3)=CC=CC2C1[Si](C)(C)C1C(C)CC2C(c3cc(C(C)(C)C)c(C)c(C(C)(C)C)c3)=CC=CC21 |
| InChI | InChI=1S/C54H72Si/c1-12-13-14-16-25-39-33-48-44(43-27-20-19-26-41(43)38-23-17-15-18-24-38)29-22-31-46(48)52(39)55(10,11)51-36(2)32-47-42(28-21-30-45(47)51)40-34-49(53(4,5)6)37(3)50(35-40)54(7,8)9/h15,17-24,26-31,34-36,39,45-48,51-52H,12-14,16,25,32-33H2,1-11H3 |
| InChIKey | CEDXHZWJTUECKY-UHFFFAOYSA-N |
| XLogP | 15.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.26 |
| LogP ≤ 5 | 15.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|