C56H80O2Si — CID 140679016
bis[2-cyclopropyl-4-(3,5-ditert-butyl-4-methoxyphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane (PubChem CID 140679016) has the molecular formula C56H80O2Si and a molecular weight of 813.34 g/mol. Its IUPAC name is bis[2-cyclopropyl-4-(3,5-ditert-butyl-4-methoxyphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane.
| Compound Name | bis[2-cyclopropyl-4-(3,5-ditert-butyl-4-methoxyphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 140679016 |
| Molecular Formula | C56H80O2Si |
| Molecular Weight | 813.34 g/mol |
| Exact Mass | 812.59 |
| IUPAC Name | bis[2-cyclopropyl-4-(3,5-ditert-butyl-4-methoxyphenyl)-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane |
| SMILES | COc1c(C(C)(C)C)cc(C2=CC=CC3C2CC(C2CC2)C3[Si](C)(C)C2C3C=CC=C(c4cc(C(C)(C)C)c(OC)c(C(C)(C)C)c4)C3CC2C2CC2)cc1C(C)(C)C |
| InChI | InChI=1S/C56H80O2Si/c1-53(2,3)45-27-35(28-46(49(45)57-13)54(4,5)6)37-19-17-21-39-43(37)31-41(33-23-24-33)51(39)59(15,16)52-40-22-18-20-38(44(40)32-42(52)34-25-26-34)36-29-47(55(7,8)9)50(58-14)48(30-36)56(10,11)12/h17-22,27-30,33-34,39-44,51-52H,23-26,31-32H2,1-16H3 |
| InChIKey | OZFWXTUQAFPLNY-UHFFFAOYSA-N |
| XLogP | 15.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.34 |
| LogP ≤ 5 | 15.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|