C52H76O2Si — CID 140679013
bis[4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane (PubChem CID 140679013) has the molecular formula C52H76O2Si and a molecular weight of 761.26 g/mol. Its IUPAC name is bis[4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane.
| Compound Name | bis[4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 140679013 |
| Molecular Formula | C52H76O2Si |
| Molecular Weight | 761.26 g/mol |
| Exact Mass | 760.56 |
| IUPAC Name | bis[4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane |
| SMILES | COc1c(C(C)(C)C)cc(C2=CC=CC3C2CC(C)C3[Si](C)(C)C2C(C)CC3C(c4cc(C(C)(C)C)c(OC)c(C(C)(C)C)c4)=CC=CC32)cc1C(C)(C)C |
| InChI | InChI=1S/C52H76O2Si/c1-31-25-39-35(33-27-41(49(3,4)5)45(53-15)42(28-33)50(6,7)8)21-19-23-37(39)47(31)55(17,18)48-32(2)26-40-36(22-20-24-38(40)48)34-29-43(51(9,10)11)46(54-16)44(30-34)52(12,13)14/h19-24,27-32,37-40,47-48H,25-26H2,1-18H3 |
| InChIKey | TXXBLYWQJXSLMM-UHFFFAOYSA-N |
| XLogP | 14.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.26 |
| LogP ≤ 5 | 14.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|