C35H44Si — CID 162694927
(4-anthracen-9-yl-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethyl-(2,3,4,5-tetramethylcyclopentyl)silane (PubChem CID 162694927) has the molecular formula C35H44Si and a molecular weight of 492.82 g/mol. Its IUPAC name is (4-anthracen-9-yl-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethyl-(2,3,4,5-tetramethylcyclopentyl)silane.
| Compound Name | (4-anthracen-9-yl-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethyl-(2,3,4,5-tetramethylcyclopentyl)silane |
|---|---|
| PubChem CID | 162694927 |
| Molecular Formula | C35H44Si |
| Molecular Weight | 492.82 g/mol |
| Exact Mass | 492.32 |
| IUPAC Name | (4-anthracen-9-yl-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethyl-(2,3,4,5-tetramethylcyclopentyl)silane |
| SMILES | CC1CC2C(c3c4ccccc4cc4ccccc34)=CC=CC2C1[Si](C)(C)C1C(C)C(C)C(C)C1C |
| InChI | InChI=1S/C35H44Si/c1-21-19-32-30(33-28-15-10-8-13-26(28)20-27-14-9-11-16-29(27)33)17-12-18-31(32)34(21)36(6,7)35-24(4)22(2)23(3)25(35)5/h8-18,20-25,31-32,34-35H,19H2,1-7H3 |
| InChIKey | QSZJWKDIYSRUDM-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.82 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|