C49H60Si — CID 72574460
[4-(4-tert-butylphenyl)-2-propan-2-yl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-(2-methyl-4,8-diphenyl-1,2,3,3a,5,6,7,8a-octahydro-s-indacen-1-yl)silane (PubChem CID 72574460) has the molecular formula C49H60Si and a molecular weight of 677.11 g/mol. Its IUPAC name is [4-(4-tert-butylphenyl)-2-propan-2-yl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-(2-methyl-4,8-diphenyl-1,2,3,3a,5,6,7,8a-octahydro-s-indacen-1-yl)silane.
| Compound Name | [4-(4-tert-butylphenyl)-2-propan-2-yl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-(2-methyl-4,8-diphenyl-1,2,3,3a,5,6,7,8a-octahydro-s-indacen-1-yl)silane |
|---|---|
| PubChem CID | 72574460 |
| Molecular Formula | C49H60Si |
| Molecular Weight | 677.11 g/mol |
| Exact Mass | 676.45 |
| IUPAC Name | [4-(4-tert-butylphenyl)-2-propan-2-yl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethyl-(2-methyl-4,8-diphenyl-1,2,3,3a,5,6,7,8a-octahydro-s-indacen-1-yl)silane |
| SMILES | CC(C)C1CC2C(c3ccc(C(C)(C)C)cc3)=CC=CC2C1[Si](C)(C)C1C(C)CC2C(c3ccccc3)=C3CCCC3=C(c3ccccc3)C21 |
| InChI | InChI=1S/C49H60Si/c1-31(2)41-30-42-37(33-25-27-36(28-26-33)49(4,5)6)21-15-24-40(42)48(41)50(7,8)47-32(3)29-43-44(34-17-11-9-12-18-34)38-22-16-23-39(38)45(46(43)47)35-19-13-10-14-20-35/h9-15,17-21,24-28,31-32,40-43,46-48H,16,22-23,29-30H2,1-8H3 |
| InChIKey | UFVLKEKYQJABHI-UHFFFAOYSA-N |
| XLogP | 13.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.11 |
| LogP ≤ 5 | 13.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|