C26H38Si — CID 162289121
1-(2-methylbutyl)-1-(2-methyl-4-phenyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)silinane (PubChem CID 162289121) has the molecular formula C26H38Si and a molecular weight of 378.68 g/mol. Its IUPAC name is 1-(2-methylbutyl)-1-(2-methyl-4-phenyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)silinane.
| Compound Name | 1-(2-methylbutyl)-1-(2-methyl-4-phenyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)silinane |
|---|---|
| PubChem CID | 162289121 |
| Molecular Formula | C26H38Si |
| Molecular Weight | 378.68 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | 1-(2-methylbutyl)-1-(2-methyl-4-phenyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)silinane |
| SMILES | CCC(C)C[Si]1(C2C(C)CC3C(c4ccccc4)=CC=CC32)CCCCC1 |
| InChI | InChI=1S/C26H38Si/c1-4-20(2)19-27(16-9-6-10-17-27)26-21(3)18-25-23(14-11-15-24(25)26)22-12-7-5-8-13-22/h5,7-8,11-15,20-21,24-26H,4,6,9-10,16-19H2,1-3H3 |
| InChIKey | WCXFXTXEGZKNAW-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.68 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|