C30H37Cl2N3SiTi-2 — CID 58634621
[(2S,3aS)-2-ethyl-7-phenyl-3a,7a-dihydro-2H-imidazo[4,5-b]pyridin-1-id-3-yl]-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-dimethylsilane;carbanide;dichlorotitanium (PubChem CID 58634621) has the molecular formula C30H37Cl2N3SiTi-2 and a molecular weight of 586.51 g/mol. Its IUPAC name is [(2S,3aS)-2-ethyl-7-phenyl-3a,7a-dihydro-2H-imidazo[4,5-b]pyridin-1-id-3-yl]-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-dimethylsilane;carbanide;dichlorotitanium.
| Compound Name | [(2S,3aS)-2-ethyl-7-phenyl-3a,7a-dihydro-2H-imidazo[4,5-b]pyridin-1-id-3-yl]-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-dimethylsilane;carbanide;dichlorotitanium |
|---|---|
| PubChem CID | 58634621 |
| Molecular Formula | C30H37Cl2N3SiTi-2 |
| Molecular Weight | 586.51 g/mol |
| Exact Mass | 585.16 |
| IUPAC Name | [(2S,3aS)-2-ethyl-7-phenyl-3a,7a-dihydro-2H-imidazo[4,5-b]pyridin-1-id-3-yl]-(4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-dimethylsilane;carbanide;dichlorotitanium |
| SMILES | CC[C@H]1[N-]C2C(c3ccccc3)=CC=N[C@H]2N1[Si](C)(C)C1C2C=CC=CC2C2C=CC=CC21.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C29H34N3Si.CH3.2ClH.Ti/c1-4-26-31-27-21(20-12-6-5-7-13-20)18-19-30-29(27)32(26)33(2,3)28-24-16-10-8-14-22(24)23-15-9-11-17-25(23)28;;;;/h5-19,22-29H,4H2,1-3H3;1H3;2*1H;/q2*-1;;;+2/p-2/t22?,23?,24?,25?,26-,27?,28?,29-;;;;/m0..../s1 |
| InChIKey | NTHFOHRLWNHJPU-RJAYPUTFSA-L |
| XLogP | 8.41 |
| TPSA | 29.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.51 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|