C18H38O8 — CID 140523652
1-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-3,3-dimethylbutan-2-ol (PubChem CID 140523652) has the molecular formula C18H38O8 and a molecular weight of 382.49 g/mol. Its IUPAC name is 1-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-3,3-dimethylbutan-2-ol.
| Compound Name | 1-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 140523652 |
| Molecular Formula | C18H38O8 |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | 1-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-3,3-dimethylbutan-2-ol |
| SMILES | CC(C)(C)C(O)COCCOCCOCCOCCOCCOCCO |
| InChI | InChI=1S/C18H38O8/c1-18(2,3)17(20)16-26-15-14-25-13-12-24-11-10-23-9-8-22-7-6-21-5-4-19/h17,19-20H,4-16H2,1-3H3 |
| InChIKey | QLEFZJUGUXSLGF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|