C28H38O8 — CID 140528218
[(3R,4S,5S,6R)-4-[(3R)-2,3-dimethyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-5-methoxy-1-oxaspiro[2.5]octan-6-yl] (E)-3-(3-hydroxy-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 140528218) has the molecular formula C28H38O8 and a molecular weight of 502.60 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-4-[(3R)-2,3-dimethyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-5-methoxy-1-oxaspiro[2.5]octan-6-yl] (E)-3-(3-hydroxy-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [(3R,4S,5S,6R)-4-[(3R)-2,3-dimethyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-5-methoxy-1-oxaspiro[2.5]octan-6-yl] (E)-3-(3-hydroxy-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 140528218 |
| Molecular Formula | C28H38O8 |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | [(3R,4S,5S,6R)-4-[(3R)-2,3-dimethyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-5-methoxy-1-oxaspiro[2.5]octan-6-yl] (E)-3-(3-hydroxy-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H]2CC[C@]3(CO3)[C@@H](C3(C)O[C@]3(C)CC=C(C)C)[C@@H]2OC)cc(O)c1OC |
| InChI | InChI=1S/C28H38O8/c1-17(2)10-12-26(3)27(4,36-26)25-24(33-7)20(11-13-28(25)16-34-28)35-22(30)9-8-18-14-19(29)23(32-6)21(15-18)31-5/h8-10,14-15,20,24-25,29H,11-13,16H2,1-7H3/b9-8+/t20-,24-,25-,26-,27?,28+/m1/s1 |
| InChIKey | JTLBCNBLKQEAFS-CJIWBCRQSA-N |
| XLogP | 4.43 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|