C32H37ClN6O2 — CID 140534968
5-[(3R)-3-[4-[benzyl-[(4-cyanophenyl)carbamoyl]amino]piperidin-1-yl]butyl]-6-chloro-2,4-dimethylpyridine-3-carboxamide (PubChem CID 140534968) has the molecular formula C32H37ClN6O2 and a molecular weight of 573.14 g/mol. Its IUPAC name is 5-[(3R)-3-[4-[benzyl-[(4-cyanophenyl)carbamoyl]amino]piperidin-1-yl]butyl]-6-chloro-2,4-dimethylpyridine-3-carboxamide.
| Compound Name | 5-[(3R)-3-[4-[benzyl-[(4-cyanophenyl)carbamoyl]amino]piperidin-1-yl]butyl]-6-chloro-2,4-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 140534968 |
| Molecular Formula | C32H37ClN6O2 |
| Molecular Weight | 573.14 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | 5-[(3R)-3-[4-[benzyl-[(4-cyanophenyl)carbamoyl]amino]piperidin-1-yl]butyl]-6-chloro-2,4-dimethylpyridine-3-carboxamide |
| SMILES | Cc1nc(Cl)c(CC[C@@H](C)N2CCC(N(Cc3ccccc3)C(=O)Nc3ccc(C#N)cc3)CC2)c(C)c1C(N)=O |
| InChI | InChI=1S/C32H37ClN6O2/c1-21(9-14-28-22(2)29(31(35)40)23(3)36-30(28)33)38-17-15-27(16-18-38)39(20-25-7-5-4-6-8-25)32(41)37-26-12-10-24(19-34)11-13-26/h4-8,10-13,21,27H,9,14-18,20H2,1-3H3,(H2,35,40)(H,37,41)/t21-/m1/s1 |
| InChIKey | MRWYURGBTAYQSF-OAQYLSRUSA-N |
| XLogP | 5.84 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.14 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|