C21H20FN3O5S — CID 140535293
prop-2-enyl (5S)-2-diazo-5-(4-fluorophenyl)-5-[(4-methylphenyl)sulfonylamino]-3-oxopentanoate (PubChem CID 140535293) has the molecular formula C21H20FN3O5S and a molecular weight of 445.47 g/mol. Its IUPAC name is prop-2-enyl (5S)-2-diazo-5-(4-fluorophenyl)-5-[(4-methylphenyl)sulfonylamino]-3-oxopentanoate.
| Compound Name | prop-2-enyl (5S)-2-diazo-5-(4-fluorophenyl)-5-[(4-methylphenyl)sulfonylamino]-3-oxopentanoate |
|---|---|
| PubChem CID | 140535293 |
| Molecular Formula | C21H20FN3O5S |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | prop-2-enyl (5S)-2-diazo-5-(4-fluorophenyl)-5-[(4-methylphenyl)sulfonylamino]-3-oxopentanoate |
| SMILES | C=CCOC(=O)C(=[N+]=[N-])C(=O)C[C@H](NS(=O)(=O)c1ccc(C)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H20FN3O5S/c1-3-12-30-21(27)20(24-23)19(26)13-18(15-6-8-16(22)9-7-15)25-31(28,29)17-10-4-14(2)5-11-17/h3-11,18,25H,1,12-13H2,2H3/t18-/m0/s1 |
| InChIKey | XMTVUKPCRJZIEM-SFHVURJKSA-N |
| XLogP | 2.51 |
| TPSA | 125.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|