C14H23BrN2O3SSi — CID 140541226
5-bromo-1-[(2R,4R,5S)-5-(hydroxymethyl)-4-(2-trimethylsilylethyl)oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 140541226) has the molecular formula C14H23BrN2O3SSi and a molecular weight of 407.41 g/mol. Its IUPAC name is 5-bromo-1-[(2R,4R,5S)-5-(hydroxymethyl)-4-(2-trimethylsilylethyl)oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-bromo-1-[(2R,4R,5S)-5-(hydroxymethyl)-4-(2-trimethylsilylethyl)oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 140541226 |
| Molecular Formula | C14H23BrN2O3SSi |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 5-bromo-1-[(2R,4R,5S)-5-(hydroxymethyl)-4-(2-trimethylsilylethyl)oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | C[Si](C)(C)CC[C@H]1C[C@H](n2cc(Br)c(=O)[nH]c2=S)O[C@@H]1CO |
| InChI | InChI=1S/C14H23BrN2O3SSi/c1-22(2,3)5-4-9-6-12(20-11(9)8-18)17-7-10(15)13(19)16-14(17)21/h7,9,11-12,18H,4-6,8H2,1-3H3,(H,16,19,21)/t9-,11+,12+/m0/s1 |
| InChIKey | HFSYQIZRLYWMLE-MVWJERBFSA-N |
| XLogP | 3.29 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|