C47H61BrF2O8S3 — CID 140547815
9-(4-bromophenyl)sulfonyloxynonyl 2,2-difluoro-2-[tris(2-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylacetate (PubChem CID 140547815) has the molecular formula C47H61BrF2O8S3 and a molecular weight of 968.10 g/mol. Its IUPAC name is 9-(4-bromophenyl)sulfonyloxynonyl 2,2-difluoro-2-[tris(2-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylacetate.
| Compound Name | 9-(4-bromophenyl)sulfonyloxynonyl 2,2-difluoro-2-[tris(2-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylacetate |
|---|---|
| PubChem CID | 140547815 |
| Molecular Formula | C47H61BrF2O8S3 |
| Molecular Weight | 968.10 g/mol |
| Exact Mass | 966.27 |
| IUPAC Name | 9-(4-bromophenyl)sulfonyloxynonyl 2,2-difluoro-2-[tris(2-tert-butylphenyl)-λ4-sulfanyl]oxysulfonylacetate |
| SMILES | CC(C)(C)c1ccccc1S(OS(=O)(=O)C(F)(F)C(=O)OCCCCCCCCCOS(=O)(=O)c1ccc(Br)cc1)(c1ccccc1C(C)(C)C)c1ccccc1C(C)(C)C |
| InChI | InChI=1S/C47H61BrF2O8S3/c1-44(2,3)37-23-15-18-26-40(37)59(41-27-19-16-24-38(41)45(4,5)6,42-28-20-17-25-39(42)46(7,8)9)58-61(54,55)47(49,50)43(51)56-33-21-13-11-10-12-14-22-34-57-60(52,53)36-31-29-35(48)30-32-36/h15-20,23-32H,10-14,21-22,33-34H2,1-9H3 |
| InChIKey | CEPBHGJAMXHYAM-UHFFFAOYSA-N |
| XLogP | 13.16 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 968.10 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|