About 7,7a-dihydrooxireno[2,3-b]chromene-1a-carbonitrile
7,7a-dihydrooxireno[2,3-b]chromene-1a-carbonitrile (PubChem CID 140556460) has the molecular formula C10H7NO2
and a molecular weight of 173.17 g/mol. Its IUPAC name is 7,7a-dihydrooxireno[2,3-b]chromene-1a-carbonitrile.
Molecular Properties
| Compound Name | 7,7a-dihydrooxireno[2,3-b]chromene-1a-carbonitrile |
| PubChem CID | 140556460 |
| Molecular Formula | C10H7NO2 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 7,7a-dihydrooxireno[2,3-b]chromene-1a-carbonitrile |
| SMILES | N#CC12Oc3ccccc3CC1O2 |
| InChI | InChI=1S/C10H7NO2/c11-6-10-9(13-10)5-7-3-1-2-4-8(7)12-10/h1-4,9H,5H2 |
| InChIKey | ZDWGNRAANMFIAX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 7,7a-dihydrooxireno[2,3-b]chromene-1a-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7a-dihydrooxireno[2,3-b]chromene-1a-carbonitrile?
The IUPAC name of 7,7a-dihydrooxireno[2,3-b]chromene-1a-carbonitrile (CID 140556460) is 7,7a-dihydrooxireno[2,3-b]chromene-1a-carbonitrile.
What is the SMILES notation for 7,7a-dihydrooxireno[2,3-b]chromene-1a-carbonitrile?
The canonical SMILES for 7,7a-dihydrooxireno[2,3-b]chromene-1a-carbonitrile is N#CC12Oc3ccccc3CC1O2.
What is the InChIKey of 7,7a-dihydrooxireno[2,3-b]chromene-1a-carbonitrile?
The InChIKey is ZDWGNRAANMFIAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2/c11-6-10-9(13-10)5-7-3-1-2-4-8(7)12-10/h1-4,9H,5H2.
What are the key properties of 7,7a-dihydrooxireno[2,3-b]chromene-1a-carbonitrile?
7,7a-dihydrooxireno[2,3-b]chromene-1a-carbonitrile has a molecular weight of 173.17 g/mol, XLogP of 1.24, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7a-dihydrooxireno[2,3-b]chromene-1a-carbonitrile is sourced from PubChem (CID 140556460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).