C11H10FNO — CID 141163115
2-(2-fluoro-3,4-dihydrochromen-2-yl)acetonitrile (PubChem CID 141163115) has the molecular formula C11H10FNO and a molecular weight of 191.21 g/mol. Its IUPAC name is 2-(2-fluoro-3,4-dihydrochromen-2-yl)acetonitrile.
| Compound Name | 2-(2-fluoro-3,4-dihydrochromen-2-yl)acetonitrile |
|---|---|
| PubChem CID | 141163115 |
| Molecular Formula | C11H10FNO |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 2-(2-fluoro-3,4-dihydrochromen-2-yl)acetonitrile |
| SMILES | N#CCC1(F)CCc2ccccc2O1 |
| InChI | InChI=1S/C11H10FNO/c12-11(7-8-13)6-5-9-3-1-2-4-10(9)14-11/h1-4H,5-7H2 |
| InChIKey | KVVHSGSRMLANRX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |