C19H16O2 — CID 19084225
3,3'-dimethylidene-2,2'-spirobi[4H-chromene] (PubChem CID 19084225) has the molecular formula C19H16O2 and a molecular weight of 276.33 g/mol. Its IUPAC name is 3,3'-dimethylidene-2,2'-spirobi[4H-chromene].
| Compound Name | 3,3'-dimethylidene-2,2'-spirobi[4H-chromene] |
|---|---|
| PubChem CID | 19084225 |
| Molecular Formula | C19H16O2 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 3,3'-dimethylidene-2,2'-spirobi[4H-chromene] |
| SMILES | C=C1Cc2ccccc2OC12Oc1ccccc1CC2=C |
| InChI | InChI=1S/C19H16O2/c1-13-11-15-7-3-5-9-17(15)20-19(13)14(2)12-16-8-4-6-10-18(16)21-19/h3-10H,1-2,11-12H2 |
| InChIKey | KHKJZDDOBXLDJP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|