About 3-methoxy-5-(6-methoxy-1,2-dihydroisoquinolin-3-yl)-1,2-oxazole
3-methoxy-5-(6-methoxy-1,2-dihydroisoquinolin-3-yl)-1,2-oxazole (PubChem CID 140563549) has the molecular formula C14H14N2O3
and a molecular weight of 258.28 g/mol. Its IUPAC name is 3-methoxy-5-(6-methoxy-1,2-dihydroisoquinolin-3-yl)-1,2-oxazole.
Molecular Properties
| Compound Name | 3-methoxy-5-(6-methoxy-1,2-dihydroisoquinolin-3-yl)-1,2-oxazole |
| PubChem CID | 140563549 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 3-methoxy-5-(6-methoxy-1,2-dihydroisoquinolin-3-yl)-1,2-oxazole |
| SMILES | COc1ccc2c(c1)C=C(c1cc(OC)no1)NC2 |
| InChI | InChI=1S/C14H14N2O3/c1-17-11-4-3-9-8-15-12(6-10(9)5-11)13-7-14(18-2)16-19-13/h3-7,15H,8H2,1-2H3 |
| InChIKey | VCHZALHDUWUFEQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methoxy-5-(6-methoxy-1,2-dihydroisoquinolin-3-yl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-5-(6-methoxy-1,2-dihydroisoquinolin-3-yl)-1,2-oxazole?
The IUPAC name of 3-methoxy-5-(6-methoxy-1,2-dihydroisoquinolin-3-yl)-1,2-oxazole (CID 140563549) is 3-methoxy-5-(6-methoxy-1,2-dihydroisoquinolin-3-yl)-1,2-oxazole.
What is the SMILES notation for 3-methoxy-5-(6-methoxy-1,2-dihydroisoquinolin-3-yl)-1,2-oxazole?
The canonical SMILES for 3-methoxy-5-(6-methoxy-1,2-dihydroisoquinolin-3-yl)-1,2-oxazole is COc1ccc2c(c1)C=C(c1cc(OC)no1)NC2.
What is the InChIKey of 3-methoxy-5-(6-methoxy-1,2-dihydroisoquinolin-3-yl)-1,2-oxazole?
The InChIKey is VCHZALHDUWUFEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O3/c1-17-11-4-3-9-8-15-12(6-10(9)5-11)13-7-14(18-2)16-19-13/h3-7,15H,8H2,1-2H3.
What are the key properties of 3-methoxy-5-(6-methoxy-1,2-dihydroisoquinolin-3-yl)-1,2-oxazole?
3-methoxy-5-(6-methoxy-1,2-dihydroisoquinolin-3-yl)-1,2-oxazole has a molecular weight of 258.28 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-5-(6-methoxy-1,2-dihydroisoquinolin-3-yl)-1,2-oxazole is sourced from PubChem (CID 140563549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).