C27H26F2O4S — CID 140567464
(triphenyl-λ4-sulfanyl) 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate (PubChem CID 140567464) has the molecular formula C27H26F2O4S and a molecular weight of 484.56 g/mol. Its IUPAC name is (triphenyl-λ4-sulfanyl) 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate.
| Compound Name | (triphenyl-λ4-sulfanyl) 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate |
|---|---|
| PubChem CID | 140567464 |
| Molecular Formula | C27H26F2O4S |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | (triphenyl-λ4-sulfanyl) 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate |
| SMILES | C=C(C)C(=O)OC(CC)C(F)(F)C(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26F2O4S/c1-4-24(32-25(30)20(2)3)27(28,29)26(31)33-34(21-14-8-5-9-15-21,22-16-10-6-11-17-22)23-18-12-7-13-19-23/h5-19,24H,2,4H2,1,3H3 |
| InChIKey | RQLRVQHRVQIPPK-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|