C8H18NO2+ — CID 140575033
5-(hydroxymethyl)-2,4-dimethylpiperidin-1-ium-3-ol (PubChem CID 140575033) has the molecular formula C8H18NO2+ and a molecular weight of 160.24 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2,4-dimethylpiperidin-1-ium-3-ol.
| Compound Name | 5-(hydroxymethyl)-2,4-dimethylpiperidin-1-ium-3-ol |
|---|---|
| PubChem CID | 140575033 |
| Molecular Formula | C8H18NO2+ |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 5-(hydroxymethyl)-2,4-dimethylpiperidin-1-ium-3-ol |
| SMILES | CC1[NH2+]CC(CO)C(C)C1O |
| InChI | InChI=1S/C8H17NO2/c1-5-7(4-10)3-9-6(2)8(5)11/h5-11H,3-4H2,1-2H3/p+1 |
| InChIKey | PIDKYBUIYXCJJP-UHFFFAOYSA-O |
| XLogP | -1.44 |
| TPSA | 57.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |