C19H32N2 — CID 140611359
N-butyl-2,2-dimethyl-N-(2-methylpropyl)-N'-phenylpropanimidamide (PubChem CID 140611359) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is N-butyl-2,2-dimethyl-N-(2-methylpropyl)-N'-phenylpropanimidamide.
| Compound Name | N-butyl-2,2-dimethyl-N-(2-methylpropyl)-N'-phenylpropanimidamide |
|---|---|
| PubChem CID | 140611359 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | N-butyl-2,2-dimethyl-N-(2-methylpropyl)-N'-phenylpropanimidamide |
| SMILES | CCCCN(CC(C)C)/C(=N/c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C19H32N2/c1-7-8-14-21(15-16(2)3)18(19(4,5)6)20-17-12-10-9-11-13-17/h9-13,16H,7-8,14-15H2,1-6H3/b20-18+ |
| InChIKey | XYSOBFWRDSZKOA-CZIZESTLSA-N |
| XLogP | 5.52 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|