About N-butyl-2,2-dimethyl-N-(2-methylpropyl)-N'-phenylpropanimidamide
N-butyl-2,2-dimethyl-N-(2-methylpropyl)-N'-phenylpropanimidamide (PubChem CID 140611359) has the molecular formula C19H32N2
and a molecular weight of 288.48 g/mol. Its IUPAC name is N-butyl-2,2-dimethyl-N-(2-methylpropyl)-N'-phenylpropanimidamide.
Molecular Properties
| Compound Name | N-butyl-2,2-dimethyl-N-(2-methylpropyl)-N'-phenylpropanimidamide |
| PubChem CID | 140611359 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | N-butyl-2,2-dimethyl-N-(2-methylpropyl)-N'-phenylpropanimidamide |
| SMILES | CCCCN(CC(C)C)/C(=N/c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C19H32N2/c1-7-8-14-21(15-16(2)3)18(19(4,5)6)20-17-12-10-9-11-13-17/h9-13,16H,7-8,14-15H2,1-6H3/b20-18+ |
| InChIKey | XYSOBFWRDSZKOA-CZIZESTLSA-N |
| XLogP | 5.52 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2,2-dimethyl-N-(2-methylpropyl)-N'-phenylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2,2-dimethyl-N-(2-methylpropyl)-N'-phenylpropanimidamide?
The IUPAC name of N-butyl-2,2-dimethyl-N-(2-methylpropyl)-N'-phenylpropanimidamide (CID 140611359) is N-butyl-2,2-dimethyl-N-(2-methylpropyl)-N'-phenylpropanimidamide.
What is the SMILES notation for N-butyl-2,2-dimethyl-N-(2-methylpropyl)-N'-phenylpropanimidamide?
The canonical SMILES for N-butyl-2,2-dimethyl-N-(2-methylpropyl)-N'-phenylpropanimidamide is CCCCN(CC(C)C)/C(=N/c1ccccc1)C(C)(C)C.
What is the InChIKey of N-butyl-2,2-dimethyl-N-(2-methylpropyl)-N'-phenylpropanimidamide?
The InChIKey is XYSOBFWRDSZKOA-CZIZESTLSA-N. The full InChI is InChI=1S/C19H32N2/c1-7-8-14-21(15-16(2)3)18(19(4,5)6)20-17-12-10-9-11-13-17/h9-13,16H,7-8,14-15H2,1-6H3/b20-18+.
What are the key properties of N-butyl-2,2-dimethyl-N-(2-methylpropyl)-N'-phenylpropanimidamide?
N-butyl-2,2-dimethyl-N-(2-methylpropyl)-N'-phenylpropanimidamide has a molecular weight of 288.48 g/mol, XLogP of 5.52, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2,2-dimethyl-N-(2-methylpropyl)-N'-phenylpropanimidamide is sourced from PubChem (CID 140611359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).