About (benzhydrylidene-λ4-sulfanylidene)methanamine
(benzhydrylidene-λ4-sulfanylidene)methanamine (PubChem CID 140620164) has the molecular formula C14H13NS
and a molecular weight of 227.33 g/mol. Its IUPAC name is (benzhydrylidene-λ4-sulfanylidene)methanamine.
Molecular Properties
| Compound Name | (benzhydrylidene-λ4-sulfanylidene)methanamine |
| PubChem CID | 140620164 |
| Molecular Formula | C14H13NS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | (benzhydrylidene-λ4-sulfanylidene)methanamine |
| SMILES | NC=S=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H13NS/c15-11-16-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-11H,15H2 |
| InChIKey | SYQSHSJILCKEHJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (benzhydrylidene-λ4-sulfanylidene)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (benzhydrylidene-λ4-sulfanylidene)methanamine?
The IUPAC name of (benzhydrylidene-λ4-sulfanylidene)methanamine (CID 140620164) is (benzhydrylidene-λ4-sulfanylidene)methanamine.
What is the SMILES notation for (benzhydrylidene-λ4-sulfanylidene)methanamine?
The canonical SMILES for (benzhydrylidene-λ4-sulfanylidene)methanamine is NC=S=C(c1ccccc1)c1ccccc1.
What is the InChIKey of (benzhydrylidene-λ4-sulfanylidene)methanamine?
The InChIKey is SYQSHSJILCKEHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NS/c15-11-16-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-11H,15H2.
What are the key properties of (benzhydrylidene-λ4-sulfanylidene)methanamine?
(benzhydrylidene-λ4-sulfanylidene)methanamine has a molecular weight of 227.33 g/mol, XLogP of 2.71, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (benzhydrylidene-λ4-sulfanylidene)methanamine is sourced from PubChem (CID 140620164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).