C35H47Si3 — CID 140631740
CID 140631740 (PubChem CID 140631740) has the molecular formula C35H47Si3 and a molecular weight of 552.02 g/mol.
| Compound Name | CID 140631740 |
|---|---|
| PubChem CID | 140631740 |
| Molecular Formula | C35H47Si3 |
| Molecular Weight | 552.02 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | — |
| SMILES | CC1=C(C)C(C)([Si](c2cccc([Si](C)(C)C)c2)c2cccc([Si](C)(C)C)c2)C(c2cc(C)cc(C)c2)=C1C |
| InChI | InChI=1S/C35H47Si3/c1-24-19-25(2)21-29(20-24)34-27(4)26(3)28(5)35(34,6)36(30-15-13-17-32(22-30)37(7,8)9)31-16-14-18-33(23-31)38(10,11)12/h13-23H,1-12H3 |
| InChIKey | HWTMDCAAYAXYNP-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.02 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|