C12H14NO2+ — CID 140636937
1-propan-2-ylquinolin-1-ium-3,4-diol (PubChem CID 140636937) has the molecular formula C12H14NO2+ and a molecular weight of 204.25 g/mol. Its IUPAC name is 1-propan-2-ylquinolin-1-ium-3,4-diol.
| Compound Name | 1-propan-2-ylquinolin-1-ium-3,4-diol |
|---|---|
| PubChem CID | 140636937 |
| Molecular Formula | C12H14NO2+ |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 1-propan-2-ylquinolin-1-ium-3,4-diol |
| SMILES | CC(C)[n+]1cc(O)c(O)c2ccccc21 |
| InChI | InChI=1S/C12H13NO2/c1-8(2)13-7-11(14)12(15)9-5-3-4-6-10(9)13/h3-8,14H,1-2H3/p+1 |
| InChIKey | LLWXLBFWFVGTFQ-UHFFFAOYSA-O |
| XLogP | 2.12 |
| TPSA | 44.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|