C15H20NO2S+ — CID 140639227
2-propan-2-yl-8-propan-2-ylsulfanylisoquinolin-2-ium-5,6-diol (PubChem CID 140639227) has the molecular formula C15H20NO2S+ and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-propan-2-yl-8-propan-2-ylsulfanylisoquinolin-2-ium-5,6-diol.
| Compound Name | 2-propan-2-yl-8-propan-2-ylsulfanylisoquinolin-2-ium-5,6-diol |
|---|---|
| PubChem CID | 140639227 |
| Molecular Formula | C15H20NO2S+ |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-propan-2-yl-8-propan-2-ylsulfanylisoquinolin-2-ium-5,6-diol |
| SMILES | CC(C)Sc1cc(O)c(O)c2cc[n+](C(C)C)cc12 |
| InChI | InChI=1S/C15H19NO2S/c1-9(2)16-6-5-11-12(8-16)14(19-10(3)4)7-13(17)15(11)18/h5-10,18H,1-4H3/p+1 |
| InChIKey | FPCCHYYGGWOIRF-UHFFFAOYSA-O |
| XLogP | 3.62 |
| TPSA | 44.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|