C18H35N3O3S — CID 140640958
2-[2-(hydroxysulfanylmethyl)-4-methoxy-3,5,6-trimethylpiperidin-1-yl]-5-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-benzimidazole (PubChem CID 140640958) has the molecular formula C18H35N3O3S and a molecular weight of 373.56 g/mol. Its IUPAC name is 2-[2-(hydroxysulfanylmethyl)-4-methoxy-3,5,6-trimethylpiperidin-1-yl]-5-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-benzimidazole.
| Compound Name | 2-[2-(hydroxysulfanylmethyl)-4-methoxy-3,5,6-trimethylpiperidin-1-yl]-5-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-benzimidazole |
|---|---|
| PubChem CID | 140640958 |
| Molecular Formula | C18H35N3O3S |
| Molecular Weight | 373.56 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 2-[2-(hydroxysulfanylmethyl)-4-methoxy-3,5,6-trimethylpiperidin-1-yl]-5-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-benzimidazole |
| SMILES | COC1CCC2NC(N3C(C)C(C)C(OC)C(C)C3CSO)NC2C1 |
| InChI | InChI=1S/C18H35N3O3S/c1-10-12(3)21(16(9-25-22)11(2)17(10)24-5)18-19-14-7-6-13(23-4)8-15(14)20-18/h10-20,22H,6-9H2,1-5H3 |
| InChIKey | FJHFAIMCVGHTDR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 65.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.56 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|