C22H10NaO5P — CID 140657329
sodium (2-oxido-2-oxo-1,2λ5-oxaphospholan-4-yl)methyl octadeca-2,4,6,8,10,12,14,16-octaynoate (PubChem CID 140657329) has the molecular formula C22H10NaO5P and a molecular weight of 408.28 g/mol. Its IUPAC name is sodium (2-oxido-2-oxo-1,2λ5-oxaphospholan-4-yl)methyl octadeca-2,4,6,8,10,12,14,16-octaynoate.
| Compound Name | sodium (2-oxido-2-oxo-1,2λ5-oxaphospholan-4-yl)methyl octadeca-2,4,6,8,10,12,14,16-octaynoate |
|---|---|
| PubChem CID | 140657329 |
| Molecular Formula | C22H10NaO5P |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | sodium (2-oxido-2-oxo-1,2λ5-oxaphospholan-4-yl)methyl octadeca-2,4,6,8,10,12,14,16-octaynoate |
| SMILES | CC#CC#CC#CC#CC#CC#CC#CC#CC(=O)OCC1COP(=O)([O-])C1.[Na+] |
| InChI | InChI=1S/C22H11O5P.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(23)26-18-21-19-27-28(24,25)20-21;/h21H,18-20H2,1H3,(H,24,25);/q;+1/p-1 |
| InChIKey | PFYACHPFDJIFOH-UHFFFAOYSA-M |
| XLogP | -3.22 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|