C14H18F3NO2S — CID 140665067
(4S)-4-(difluoromethyl)-4-(2-fluorophenyl)-2-methyl-6-oxohexane-2-sulfinamide (PubChem CID 140665067) has the molecular formula C14H18F3NO2S and a molecular weight of 321.36 g/mol. Its IUPAC name is (4S)-4-(difluoromethyl)-4-(2-fluorophenyl)-2-methyl-6-oxohexane-2-sulfinamide.
| Compound Name | (4S)-4-(difluoromethyl)-4-(2-fluorophenyl)-2-methyl-6-oxohexane-2-sulfinamide |
|---|---|
| PubChem CID | 140665067 |
| Molecular Formula | C14H18F3NO2S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (4S)-4-(difluoromethyl)-4-(2-fluorophenyl)-2-methyl-6-oxohexane-2-sulfinamide |
| SMILES | CC(C)(C[C@@](CC=O)(c1ccccc1F)C(F)F)S(N)=O |
| InChI | InChI=1S/C14H18F3NO2S/c1-13(2,21(18)20)9-14(7-8-19,12(16)17)10-5-3-4-6-11(10)15/h3-6,8,12H,7,9,18H2,1-2H3/t14-,21?/m0/s1 |
| InChIKey | ZKOLRAPUIXOFLG-YXWRBFHGSA-N |
| XLogP | 2.71 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|