C13H15NO3 — CID 140666593
(1R,7R)-4-phenyl-3,5-dioxabicyclo[5.1.0]octane-1-carboxamide (PubChem CID 140666593) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is (1R,7R)-4-phenyl-3,5-dioxabicyclo[5.1.0]octane-1-carboxamide.
| Compound Name | (1R,7R)-4-phenyl-3,5-dioxabicyclo[5.1.0]octane-1-carboxamide |
|---|---|
| PubChem CID | 140666593 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (1R,7R)-4-phenyl-3,5-dioxabicyclo[5.1.0]octane-1-carboxamide |
| SMILES | NC(=O)[C@@]12COC(c3ccccc3)OC[C@@H]1C2 |
| InChI | InChI=1S/C13H15NO3/c14-12(15)13-6-10(13)7-16-11(17-8-13)9-4-2-1-3-5-9/h1-5,10-11H,6-8H2,(H2,14,15)/t10-,11?,13-/m0/s1 |
| InChIKey | CIWZKPNESFFQGI-BJEKPXQXSA-N |
| XLogP | 1.22 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |