C37H58N2O6Si — CID 140674045
1-[[3-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylcarbamoyloxy]ethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate (PubChem CID 140674045) has the molecular formula C37H58N2O6Si and a molecular weight of 654.97 g/mol. Its IUPAC name is 1-[[3-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylcarbamoyloxy]ethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate.
| Compound Name | 1-[[3-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylcarbamoyloxy]ethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 140674045 |
| Molecular Formula | C37H58N2O6Si |
| Molecular Weight | 654.97 g/mol |
| Exact Mass | 654.41 |
| IUPAC Name | 1-[[3-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylcarbamoyloxy]ethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OC(C)OC(=O)NCc1c(CO)cnc(C)c1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H58N2O6Si/c1-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-34(41)43-31(3)44-36(42)39-28-33-32(29-40)27-38-30(2)35(33)45-46(7,8)37(4,5)6/h10-11,13-14,16-17,19-20,22-23,27,31,40H,9,12,15,18,21,24-26,28-29H2,1-8H3,(H,39,42)/b11-10-,14-13-,17-16-,20-19-,23-22- |
| InChIKey | IJTPYDGAFYEDIH-RDOWKDNJSA-N |
| XLogP | 9.30 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.97 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|