C33H47N3O9 — CID 71493488
1-[[3-hydroxy-1-oxo-1-[2-[(2,3,4-trihydroxyphenyl)methyl]hydrazinyl]propan-2-yl]carbamoyloxy]ethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate (PubChem CID 71493488) has the molecular formula C33H47N3O9 and a molecular weight of 629.75 g/mol. Its IUPAC name is 1-[[3-hydroxy-1-oxo-1-[2-[(2,3,4-trihydroxyphenyl)methyl]hydrazinyl]propan-2-yl]carbamoyloxy]ethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate.
| Compound Name | 1-[[3-hydroxy-1-oxo-1-[2-[(2,3,4-trihydroxyphenyl)methyl]hydrazinyl]propan-2-yl]carbamoyloxy]ethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 71493488 |
| Molecular Formula | C33H47N3O9 |
| Molecular Weight | 629.75 g/mol |
| Exact Mass | 629.33 |
| IUPAC Name | 1-[[3-hydroxy-1-oxo-1-[2-[(2,3,4-trihydroxyphenyl)methyl]hydrazinyl]propan-2-yl]carbamoyloxy]ethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OC(C)OC(=O)NC(CO)C(=O)NNCc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C33H47N3O9/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-29(39)44-25(2)45-33(43)35-27(24-37)32(42)36-34-23-26-21-22-28(38)31(41)30(26)40/h4-5,7-8,10-11,13-14,16-17,21-22,25,27,34,37-38,40-41H,3,6,9,12,15,18-20,23-24H2,1-2H3,(H,35,43)(H,36,42)/b5-4-,8-7-,11-10-,14-13-,17-16- |
| InChIKey | VRVGJYNIMAEFKJ-JEBPEJKESA-N |
| XLogP | 4.82 |
| TPSA | 186.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.75 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|