C11H11N3O3S2 — CID 140674283
N-[(thiophen-2-ylsulfonylamino)methyl]pyridine-2-carboxamide (PubChem CID 140674283) has the molecular formula C11H11N3O3S2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-[(thiophen-2-ylsulfonylamino)methyl]pyridine-2-carboxamide.
| Compound Name | N-[(thiophen-2-ylsulfonylamino)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 140674283 |
| Molecular Formula | C11H11N3O3S2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | N-[(thiophen-2-ylsulfonylamino)methyl]pyridine-2-carboxamide |
| SMILES | O=C(NCNS(=O)(=O)c1cccs1)c1ccccn1 |
| InChI | InChI=1S/C11H11N3O3S2/c15-11(9-4-1-2-6-12-9)13-8-14-19(16,17)10-5-3-7-18-10/h1-7,14H,8H2,(H,13,15) |
| InChIKey | QPOHNLFDTVAIER-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|