C7H5LiN2 — CID 140676611
lithium 1,2-dihydrobenzimidazol-2-ide (PubChem CID 140676611) has the molecular formula C7H5LiN2 and a molecular weight of 124.07 g/mol. Its IUPAC name is lithium 1,2-dihydrobenzimidazol-2-ide.
| Compound Name | lithium 1,2-dihydrobenzimidazol-2-ide |
|---|---|
| PubChem CID | 140676611 |
| Molecular Formula | C7H5LiN2 |
| Molecular Weight | 124.07 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | lithium 1,2-dihydrobenzimidazol-2-ide |
| SMILES | [Li+].[c-]1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C7H5N2.Li/c1-2-4-7-6(3-1)8-5-9-7;/h1-4H,(H,8,9);/q-1;+1 |
| InChIKey | NCMPEOVLKGQPOU-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.07 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|