C16H13BrIrN- — CID 140676982
5-(3-bromobenzene-6-id-1-yl)-4-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene;iridium (PubChem CID 140676982) has the molecular formula C16H13BrIrN- and a molecular weight of 491.41 g/mol. Its IUPAC name is 5-(3-bromobenzene-6-id-1-yl)-4-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene;iridium.
| Compound Name | 5-(3-bromobenzene-6-id-1-yl)-4-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene;iridium |
|---|---|
| PubChem CID | 140676982 |
| Molecular Formula | C16H13BrIrN- |
| Molecular Weight | 491.41 g/mol |
| Exact Mass | 490.99 |
| IUPAC Name | 5-(3-bromobenzene-6-id-1-yl)-4-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene;iridium |
| SMILES | Brc1cc[c-]c(-c2cc3c(cn2)C2CCC3C2)c1.[Ir] |
| InChI | InChI=1S/C16H13BrN.Ir/c17-13-3-1-2-12(7-13)16-8-14-10-4-5-11(6-10)15(14)9-18-16;/h1,3,7-11H,4-6H2;/q-1; |
| InChIKey | GPNLJSYYDBFJIG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|