C25H32F2IN3O5Si — CID 140680084
2-[[2-[[(4aR,7R,8aS)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy]-4,6-difluoro-5-iodo-2H-imidazo[4,5-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 140680084) has the molecular formula C25H32F2IN3O5Si and a molecular weight of 647.53 g/mol. Its IUPAC name is 2-[[2-[[(4aR,7R,8aS)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy]-4,6-difluoro-5-iodo-2H-imidazo[4,5-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-[[(4aR,7R,8aS)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy]-4,6-difluoro-5-iodo-2H-imidazo[4,5-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 140680084 |
| Molecular Formula | C25H32F2IN3O5Si |
| Molecular Weight | 647.53 g/mol |
| Exact Mass | 647.11 |
| IUPAC Name | 2-[[2-[[(4aR,7R,8aS)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy]-4,6-difluoro-5-iodo-2H-imidazo[4,5-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCN1C2=CC(F)=C(I)N(F)C2=NC1O[C@H]1CO[C@@H]2COC(c3ccccc3)O[C@H]2C1 |
| InChI | InChI=1S/C25H32F2IN3O5Si/c1-37(2,3)10-9-32-15-30-19-12-18(26)22(28)31(27)23(19)29-25(30)35-17-11-20-21(33-13-17)14-34-24(36-20)16-7-5-4-6-8-16/h4-8,12,17,20-21,24-25H,9-11,13-15H2,1-3H3/t17-,20+,21-,24?,25?/m1/s1 |
| InChIKey | UBPBWOLTWAFPCN-GEEJBJSXSA-N |
| XLogP | 5.24 |
| TPSA | 64.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|