About CID 140686743
CID 140686743 (PubChem CID 140686743) has the molecular formula C14H31BN
and a molecular weight of 224.22 g/mol.
Molecular Properties
| Compound Name | CID 140686743 |
| PubChem CID | 140686743 |
| Molecular Formula | C14H31BN |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.25 |
| IUPAC Name | — |
| SMILES | CCCCN([B]C(C)(C)C(C)C)CCCC |
| InChI | InChI=1S/C14H31BN/c1-7-9-11-16(12-10-8-2)15-14(5,6)13(3)4/h13H,7-12H2,1-6H3 |
| InChIKey | LHBFGAHJBIUVLW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 140686743 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140686743?
The IUPAC name of CID 140686743 (CID 140686743) is not available.
What is the SMILES notation for CID 140686743?
The canonical SMILES for CID 140686743 is CCCCN([B]C(C)(C)C(C)C)CCCC.
What is the InChIKey of CID 140686743?
The InChIKey is LHBFGAHJBIUVLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31BN/c1-7-9-11-16(12-10-8-2)15-14(5,6)13(3)4/h13H,7-12H2,1-6H3.
What are the key properties of CID 140686743?
CID 140686743 has a molecular weight of 224.22 g/mol, XLogP of 4.36, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140686743 is sourced from PubChem (CID 140686743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).