C19H23ClN2O4 — CID 140696499
2-[4-(1-ethylpyridin-1-ium-2-yl)buta-1,3-dienyl]-N,N-dimethylaniline perchlorate (PubChem CID 140696499) has the molecular formula C19H23ClN2O4 and a molecular weight of 378.86 g/mol. Its IUPAC name is 2-[4-(1-ethylpyridin-1-ium-2-yl)buta-1,3-dienyl]-N,N-dimethylaniline perchlorate.
| Compound Name | 2-[4-(1-ethylpyridin-1-ium-2-yl)buta-1,3-dienyl]-N,N-dimethylaniline perchlorate |
|---|---|
| PubChem CID | 140696499 |
| Molecular Formula | C19H23ClN2O4 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 2-[4-(1-ethylpyridin-1-ium-2-yl)buta-1,3-dienyl]-N,N-dimethylaniline perchlorate |
| SMILES | CC[n+]1ccccc1C=CC=Cc1ccccc1N(C)C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C19H23N2.ClHO4/c1-4-21-16-10-9-14-18(21)13-7-5-11-17-12-6-8-15-19(17)20(2)3;2-1(3,4)5/h5-16H,4H2,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | OVZGUAYBPJHZGR-UHFFFAOYSA-M |
| XLogP | -0.97 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|