C29H29ClN2O5 — CID 139653930
4-[4-[2-[(1-ethylpyridin-1-ium-2-yl)methylidene]chromen-4-yl]buta-1,3-dienyl]-N,N-dimethylaniline perchlorate (PubChem CID 139653930) has the molecular formula C29H29ClN2O5 and a molecular weight of 521.01 g/mol. Its IUPAC name is 4-[4-[2-[(1-ethylpyridin-1-ium-2-yl)methylidene]chromen-4-yl]buta-1,3-dienyl]-N,N-dimethylaniline perchlorate.
| Compound Name | 4-[4-[2-[(1-ethylpyridin-1-ium-2-yl)methylidene]chromen-4-yl]buta-1,3-dienyl]-N,N-dimethylaniline perchlorate |
|---|---|
| PubChem CID | 139653930 |
| Molecular Formula | C29H29ClN2O5 |
| Molecular Weight | 521.01 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 4-[4-[2-[(1-ethylpyridin-1-ium-2-yl)methylidene]chromen-4-yl]buta-1,3-dienyl]-N,N-dimethylaniline perchlorate |
| SMILES | CC[n+]1ccccc1C=C1C=C(C=CC=Cc2ccc(N(C)C)cc2)c2ccccc2O1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C29H29N2O.ClHO4/c1-4-31-20-10-9-13-26(31)22-27-21-24(28-14-7-8-15-29(28)32-27)12-6-5-11-23-16-18-25(19-17-23)30(2)3;2-1(3,4)5/h5-22H,4H2,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | GMLIWUKVJVRDMC-UHFFFAOYSA-M |
| XLogP | 1.39 |
| TPSA | 108.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.01 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|