C29H27N2OS+ — CID 54457933
4-[2-[2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]chromen-4-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 54457933) has the molecular formula C29H27N2OS+ and a molecular weight of 451.62 g/mol. Its IUPAC name is 4-[2-[2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]chromen-4-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-[2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]chromen-4-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 54457933 |
| Molecular Formula | C29H27N2OS+ |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 4-[2-[2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]chromen-4-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CC[n+]1c(C=C2C=C(C=Cc3ccc(N(C)C)cc3)c3ccccc3O2)sc2ccccc21 |
| InChI | InChI=1S/C29H27N2OS/c1-4-31-26-10-6-8-12-28(26)33-29(31)20-24-19-22(25-9-5-7-11-27(25)32-24)16-13-21-14-17-23(18-15-21)30(2)3/h5-20H,4H2,1-3H3/q+1 |
| InChIKey | WZNLEFYDAZMCPZ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|