C33H45O5S- — CID 140708489
2,6-dicyclohexyl-4-(3,5-ditert-butylbenzoyl)oxybenzenesulfonate (PubChem CID 140708489) has the molecular formula C33H45O5S- and a molecular weight of 553.79 g/mol. Its IUPAC name is 2,6-dicyclohexyl-4-(3,5-ditert-butylbenzoyl)oxybenzenesulfonate.
| Compound Name | 2,6-dicyclohexyl-4-(3,5-ditert-butylbenzoyl)oxybenzenesulfonate |
|---|---|
| PubChem CID | 140708489 |
| Molecular Formula | C33H45O5S- |
| Molecular Weight | 553.79 g/mol |
| Exact Mass | 553.30 |
| IUPAC Name | 2,6-dicyclohexyl-4-(3,5-ditert-butylbenzoyl)oxybenzenesulfonate |
| SMILES | CC(C)(C)c1cc(C(=O)Oc2cc(C3CCCCC3)c(S(=O)(=O)[O-])c(C3CCCCC3)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H46O5S/c1-32(2,3)25-17-24(18-26(19-25)33(4,5)6)31(34)38-27-20-28(22-13-9-7-10-14-22)30(39(35,36)37)29(21-27)23-15-11-8-12-16-23/h17-23H,7-16H2,1-6H3,(H,35,36,37)/p-1 |
| InChIKey | OTRWDZQPWJVKLR-UHFFFAOYSA-M |
| XLogP | 8.50 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.79 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|