C43H47F4O5S- — CID 176603606
2,3,5,6-tetrafluoro-4-[2,4,6-tris(1-adamantyl)benzoyl]oxybenzenesulfonate (PubChem CID 176603606) has the molecular formula C43H47F4O5S- and a molecular weight of 751.90 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2,4,6-tris(1-adamantyl)benzoyl]oxybenzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(1-adamantyl)benzoyl]oxybenzenesulfonate |
|---|---|
| PubChem CID | 176603606 |
| Molecular Formula | C43H47F4O5S- |
| Molecular Weight | 751.90 g/mol |
| Exact Mass | 751.31 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(1-adamantyl)benzoyl]oxybenzenesulfonate |
| SMILES | O=C(Oc1c(F)c(F)c(S(=O)(=O)[O-])c(F)c1F)c1c(C23CC4CC(CC(C4)C2)C3)cc(C23CC4CC(CC(C4)C2)C3)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C43H48F4O5S/c44-34-36(46)39(53(49,50)51)37(47)35(45)38(34)52-40(48)33-31(42-15-24-4-25(16-42)6-26(5-24)17-42)10-30(41-12-21-1-22(13-41)3-23(2-21)14-41)11-32(33)43-18-27-7-28(19-43)9-29(8-27)20-43/h10-11,21-29H,1-9,12-20H2,(H,49,50,51)/p-1 |
| InChIKey | AOBHWLGFVAXHEN-UHFFFAOYSA-M |
| XLogP | 9.77 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.90 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|