C33H47N7O6 — CID 140717519
[(2S,3S,5S)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl] N-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyl]-N-methylcarbamate (PubChem CID 140717519) has the molecular formula C33H47N7O6 and a molecular weight of 637.78 g/mol. Its IUPAC name is [(2S,3S,5S)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl] N-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyl]-N-methylcarbamate.
| Compound Name | [(2S,3S,5S)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl] N-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 140717519 |
| Molecular Formula | C33H47N7O6 |
| Molecular Weight | 637.78 g/mol |
| Exact Mass | 637.36 |
| IUPAC Name | [(2S,3S,5S)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl] N-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyl]-N-methylcarbamate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCN(C)C(=O)O[C@@H]1O[C@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C33H47N7O6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-28(41)35-22-23-39(3)33(44)46-31-27(37-38-34)24-29(45-31)40-25-26(2)30(42)36-32(40)43/h5-6,8-9,11-12,14-15,17-18,25,27,29,31H,4,7,10,13,16,19-24H2,1-3H3,(H,35,41)(H,36,42,43)/b6-5-,9-8-,12-11-,15-14-,18-17-/t27-,29-,31-/m0/s1 |
| InChIKey | UPAGJAKJAGZVIN-IGDHLTFQSA-N |
| XLogP | 5.88 |
| TPSA | 171.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.78 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|