C13H13F3N2O4S2 — CID 140726094
5-[cyclopentyl(diazo)methyl]sulfonyl-6-sulfonyl-2-(trifluoromethyl)cyclohexa-1,3-diene (PubChem CID 140726094) has the molecular formula C13H13F3N2O4S2 and a molecular weight of 382.39 g/mol. Its IUPAC name is 5-[cyclopentyl(diazo)methyl]sulfonyl-6-sulfonyl-2-(trifluoromethyl)cyclohexa-1,3-diene.
| Compound Name | 5-[cyclopentyl(diazo)methyl]sulfonyl-6-sulfonyl-2-(trifluoromethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 140726094 |
| Molecular Formula | C13H13F3N2O4S2 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 5-[cyclopentyl(diazo)methyl]sulfonyl-6-sulfonyl-2-(trifluoromethyl)cyclohexa-1,3-diene |
| SMILES | [N-]=[N+]=C(C1CCCC1)S(=O)(=O)C1C=CC(C(F)(F)F)=CC1=S(=O)=O |
| InChI | InChI=1S/C13H13F3N2O4S2/c14-13(15,16)9-5-6-11(10(7-9)23(19)20)24(21,22)12(18-17)8-3-1-2-4-8/h5-8,11H,1-4H2 |
| InChIKey | HSJKCVRVMMQTTQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 104.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|