C19H28N2O4S2 — CID 140726095
3-[cyclohexyl(diazo)methyl]sulfonyl-1,2,6-triethyl-5-sulfonylcyclohexa-1,3-diene (PubChem CID 140726095) has the molecular formula C19H28N2O4S2 and a molecular weight of 412.58 g/mol. Its IUPAC name is 3-[cyclohexyl(diazo)methyl]sulfonyl-1,2,6-triethyl-5-sulfonylcyclohexa-1,3-diene.
| Compound Name | 3-[cyclohexyl(diazo)methyl]sulfonyl-1,2,6-triethyl-5-sulfonylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 140726095 |
| Molecular Formula | C19H28N2O4S2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 3-[cyclohexyl(diazo)methyl]sulfonyl-1,2,6-triethyl-5-sulfonylcyclohexa-1,3-diene |
| SMILES | CCC1=C(CC)C(CC)C(=S(=O)=O)C=C1S(=O)(=O)C(=[N+]=[N-])C1CCCCC1 |
| InChI | InChI=1S/C19H28N2O4S2/c1-4-14-15(5-2)17(26(22)23)12-18(16(14)6-3)27(24,25)19(21-20)13-10-8-7-9-11-13/h12-13,15H,4-11H2,1-3H3 |
| InChIKey | LJXZPPHNZAMSMM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 104.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|