C14H15F3N2O4S2 — CID 140726126
1-[cyclohexyl(diazo)methyl]sulfonyl-5-sulfonyl-6-(trifluoromethyl)cyclohexa-1,3-diene (PubChem CID 140726126) has the molecular formula C14H15F3N2O4S2 and a molecular weight of 396.41 g/mol. Its IUPAC name is 1-[cyclohexyl(diazo)methyl]sulfonyl-5-sulfonyl-6-(trifluoromethyl)cyclohexa-1,3-diene.
| Compound Name | 1-[cyclohexyl(diazo)methyl]sulfonyl-5-sulfonyl-6-(trifluoromethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 140726126 |
| Molecular Formula | C14H15F3N2O4S2 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 1-[cyclohexyl(diazo)methyl]sulfonyl-5-sulfonyl-6-(trifluoromethyl)cyclohexa-1,3-diene |
| SMILES | [N-]=[N+]=C(C1CCCCC1)S(=O)(=O)C1=CC=CC(=S(=O)=O)C1C(F)(F)F |
| InChI | InChI=1S/C14H15F3N2O4S2/c15-14(16,17)12-10(24(20)21)7-4-8-11(12)25(22,23)13(19-18)9-5-2-1-3-6-9/h4,7-9,12H,1-3,5-6H2 |
| InChIKey | ZQJVAIVIYOXXTA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 104.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|