C24H26N2OS — CID 140728505
2-(1,3-benzothiazol-2-yl)-5-(2,3,4,4,5,6-hexamethyl-1-pyridinyl)phenol (PubChem CID 140728505) has the molecular formula C24H26N2OS and a molecular weight of 390.55 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-5-(2,3,4,4,5,6-hexamethyl-1-pyridinyl)phenol.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-5-(2,3,4,4,5,6-hexamethyl-1-pyridinyl)phenol |
|---|---|
| PubChem CID | 140728505 |
| Molecular Formula | C24H26N2OS |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-5-(2,3,4,4,5,6-hexamethyl-1-pyridinyl)phenol |
| SMILES | CC1=C(C)C(C)(C)C(C)=C(C)N1c1ccc(-c2nc3ccccc3s2)c(O)c1 |
| InChI | InChI=1S/C24H26N2OS/c1-14-16(3)26(17(4)15(2)24(14,5)6)18-11-12-19(21(27)13-18)23-25-20-9-7-8-10-22(20)28-23/h7-13,27H,1-6H3 |
| InChIKey | OTHUZSQOGAHXFY-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |