C18H17N3O3S2 — CID 140751545
N-cyclohexyl-2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridine-7-carboxamide (PubChem CID 140751545) has the molecular formula C18H17N3O3S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is N-cyclohexyl-2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridine-7-carboxamide.
| Compound Name | N-cyclohexyl-2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 140751545 |
| Molecular Formula | C18H17N3O3S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | N-cyclohexyl-2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridine-7-carboxamide |
| SMILES | O=C1NC(=S)SC1=Cc1cc2cncc(C(=O)NC3CCCCC3)c2o1 |
| InChI | InChI=1S/C18H17N3O3S2/c22-16(20-11-4-2-1-3-5-11)13-9-19-8-10-6-12(24-15(10)13)7-14-17(23)21-18(25)26-14/h6-9,11H,1-5H2,(H,20,22)(H,21,23,25) |
| InChIKey | DMVKLTSVLJIBHR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|