C47H62B3N4O19P3 — CID 140751743
CID 140751743 (PubChem CID 140751743) has the molecular formula C47H62B3N4O19P3 and a molecular weight of 1112.38 g/mol.
| Compound Name | CID 140751743 |
|---|---|
| PubChem CID | 140751743 |
| Molecular Formula | C47H62B3N4O19P3 |
| Molecular Weight | 1112.38 g/mol |
| Exact Mass | 1112.35 |
| IUPAC Name | — |
| SMILES | [B][C@H]1C[C@@H](OP(=O)(OCC[N+]#[C-])OC[C@H]2O[C@@H]([B])C[C@H]2OP(=O)(OCC[N+]#[C-])OC[C@H]2O[C@@H]([B])C[C@H]2OP(=O)(OCCC#N)OCC(CCCCNC(=O)OCC2c3ccccc3-c3ccccc32)COC)[C@@H](CO)O1 |
| InChI | InChI=1S/C47H62B3N4O19P3/c1-52-18-21-63-75(58,71-38-23-44(48)68-41(38)26-55)66-30-43-40(25-46(50)70-43)73-76(59,64-22-19-53-2)67-31-42-39(24-45(49)69-42)72-74(57,62-20-10-16-51)65-28-32(27-60-3)11-8-9-17-54-47(56)61-29-37-35-14-6-4-12-33(35)34-13-5-7-15-36(34)37/h4-7,12-15,32,37-46,55H,8-11,17-31H2,3H3,(H,54,56)/t32?,38-,39-,40-,41-,42-,43-,44-,45-,46-,74?,75?,76?/m1/s1 |
| InChIKey | CQLMYXUCCDIALW-GFGQFUNVSA-N |
| XLogP | 6.13 |
| TPSA | 262.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1112.38 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|